C17H11FN4OS — CID 69121246
5-[5-(6-fluoro-3-pyridinyl)benzimidazol-1-yl]thiophene-2-carboxamide (PubChem CID 69121246) has the molecular formula C17H11FN4OS and a molecular weight of 338.37 g/mol. Its IUPAC name is 5-[5-(6-fluoro-3-pyridinyl)benzimidazol-1-yl]thiophene-2-carboxamide.
| Compound Name | 5-[5-(6-fluoro-3-pyridinyl)benzimidazol-1-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 69121246 |
| Molecular Formula | C17H11FN4OS |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 5-[5-(6-fluoro-3-pyridinyl)benzimidazol-1-yl]thiophene-2-carboxamide |
| SMILES | NC(=O)c1ccc(-n2cnc3cc(-c4ccc(F)nc4)ccc32)s1 |
| InChI | InChI=1S/C17H11FN4OS/c18-15-5-2-11(8-20-15)10-1-3-13-12(7-10)21-9-22(13)16-6-4-14(24-16)17(19)23/h1-9H,(H2,19,23) |
| InChIKey | UQFUQXNCVQYWIV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|