C27H21ClN2O3S — CID 69094517
methyl 3-[1-(2-chlorophenyl)ethoxy]-5-(5-phenylbenzimidazol-1-yl)thiophene-2-carboxylate (PubChem CID 69094517) has the molecular formula C27H21ClN2O3S and a molecular weight of 489.00 g/mol. Its IUPAC name is methyl 3-[1-(2-chlorophenyl)ethoxy]-5-(5-phenylbenzimidazol-1-yl)thiophene-2-carboxylate.
| Compound Name | methyl 3-[1-(2-chlorophenyl)ethoxy]-5-(5-phenylbenzimidazol-1-yl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 69094517 |
| Molecular Formula | C27H21ClN2O3S |
| Molecular Weight | 489.00 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | methyl 3-[1-(2-chlorophenyl)ethoxy]-5-(5-phenylbenzimidazol-1-yl)thiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(-n2cnc3cc(-c4ccccc4)ccc32)cc1OC(C)c1ccccc1Cl |
| InChI | InChI=1S/C27H21ClN2O3S/c1-17(20-10-6-7-11-21(20)28)33-24-15-25(34-26(24)27(31)32-2)30-16-29-22-14-19(12-13-23(22)30)18-8-4-3-5-9-18/h3-17H,1-2H3 |
| InChIKey | KIQNKCZHDRUJEW-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.00 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |