C26H21ClN4O4S — CID 68574400
methyl 3-[(1R)-1-(2-chlorophenyl)ethoxy]-5-[5-(2H-pyran-4-yldiazenyl)benzimidazol-1-yl]thiophene-2-carboxylate (PubChem CID 68574400) has the molecular formula C26H21ClN4O4S and a molecular weight of 521.00 g/mol. Its IUPAC name is methyl 3-[(1R)-1-(2-chlorophenyl)ethoxy]-5-[5-(2H-pyran-4-yldiazenyl)benzimidazol-1-yl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[(1R)-1-(2-chlorophenyl)ethoxy]-5-[5-(2H-pyran-4-yldiazenyl)benzimidazol-1-yl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 68574400 |
| Molecular Formula | C26H21ClN4O4S |
| Molecular Weight | 521.00 g/mol |
| Exact Mass | 520.10 |
| IUPAC Name | methyl 3-[(1R)-1-(2-chlorophenyl)ethoxy]-5-[5-(2H-pyran-4-yldiazenyl)benzimidazol-1-yl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(-n2cnc3cc(/N=N/C4=CCOC=C4)ccc32)cc1O[C@H](C)c1ccccc1Cl |
| InChI | InChI=1S/C26H21ClN4O4S/c1-16(19-5-3-4-6-20(19)27)35-23-14-24(36-25(23)26(32)33-2)31-15-28-21-13-18(7-8-22(21)31)30-29-17-9-11-34-12-10-17/h3-11,13-16H,12H2,1-2H3/b30-29+/t16-/m1/s1 |
| InChIKey | NRMUQRWXXKQKOQ-VLLOUWKNSA-N |
| XLogP | 7.18 |
| TPSA | 87.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.00 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|