C27H41N3O6SSi — CID 59821171
tert-butyl 4-[4-amino-3-[[5-methoxycarbonyl-4-(2-trimethylsilylethoxy)thiophen-2-yl]amino]phenoxy]piperidine-1-carboxylate (PubChem CID 59821171) has the molecular formula C27H41N3O6SSi and a molecular weight of 563.79 g/mol. Its IUPAC name is tert-butyl 4-[4-amino-3-[[5-methoxycarbonyl-4-(2-trimethylsilylethoxy)thiophen-2-yl]amino]phenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-amino-3-[[5-methoxycarbonyl-4-(2-trimethylsilylethoxy)thiophen-2-yl]amino]phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59821171 |
| Molecular Formula | C27H41N3O6SSi |
| Molecular Weight | 563.79 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | tert-butyl 4-[4-amino-3-[[5-methoxycarbonyl-4-(2-trimethylsilylethoxy)thiophen-2-yl]amino]phenoxy]piperidine-1-carboxylate |
| SMILES | COC(=O)c1sc(Nc2cc(OC3CCN(C(=O)OC(C)(C)C)CC3)ccc2N)cc1OCC[Si](C)(C)C |
| InChI | InChI=1S/C27H41N3O6SSi/c1-27(2,3)36-26(32)30-12-10-18(11-13-30)35-19-8-9-20(28)21(16-19)29-23-17-22(24(37-23)25(31)33-4)34-14-15-38(5,6)7/h8-9,16-18,29H,10-15,28H2,1-7H3 |
| InChIKey | DRANFTNCNSWGAG-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 112.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.79 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|