C30H38N4O4Si — CID 59824885
2-hydroxy-2-[3-[3-(2-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-5-yl]phenyl]-N,N-dimethylpropanamide (PubChem CID 59824885) has the molecular formula C30H38N4O4Si and a molecular weight of 546.74 g/mol. Its IUPAC name is 2-hydroxy-2-[3-[3-(2-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-5-yl]phenyl]-N,N-dimethylpropanamide.
| Compound Name | 2-hydroxy-2-[3-[3-(2-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-5-yl]phenyl]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 59824885 |
| Molecular Formula | C30H38N4O4Si |
| Molecular Weight | 546.74 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | 2-hydroxy-2-[3-[3-(2-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-5-yl]phenyl]-N,N-dimethylpropanamide |
| SMILES | COc1ccccc1-c1nn(COCC[Si](C)(C)C)c2ncc(-c3cccc(C(C)(O)C(=O)N(C)C)c3)cc12 |
| InChI | InChI=1S/C30H38N4O4Si/c1-30(36,29(35)33(2)3)23-12-10-11-21(17-23)22-18-25-27(24-13-8-9-14-26(24)37-4)32-34(28(25)31-19-22)20-38-15-16-39(5,6)7/h8-14,17-19,36H,15-16,20H2,1-7H3 |
| InChIKey | SEJXHROHZAUDEH-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.74 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|