C23H21FN4O4 — CID 59825015
2-[5-[3-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-1-oxidopyridin-1-ium-3-yl]-2-hydroxy-N,N-dimethylacetamide (PubChem CID 59825015) has the molecular formula C23H21FN4O4 and a molecular weight of 436.44 g/mol. Its IUPAC name is 2-[5-[3-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-1-oxidopyridin-1-ium-3-yl]-2-hydroxy-N,N-dimethylacetamide.
| Compound Name | 2-[5-[3-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-1-oxidopyridin-1-ium-3-yl]-2-hydroxy-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 59825015 |
| Molecular Formula | C23H21FN4O4 |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 2-[5-[3-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-1-oxidopyridin-1-ium-3-yl]-2-hydroxy-N,N-dimethylacetamide |
| SMILES | COc1ccc(F)cc1-c1c[nH]c2ncc(-c3cc(C(O)C(=O)N(C)C)c[n+]([O-])c3)cc12 |
| InChI | InChI=1S/C23H21FN4O4/c1-27(2)23(30)21(29)15-6-14(11-28(31)12-15)13-7-18-19(10-26-22(18)25-9-13)17-8-16(24)4-5-20(17)32-3/h4-12,21,29H,1-3H3,(H,25,26) |
| InChIKey | TYFAJXPGACEOGY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|