C29H33N5O — CID 59827333
6-methoxy-8-[4-[1-(5-methylquinolin-8-yl)piperidin-4-yl]piperazin-1-yl]quinoline (PubChem CID 59827333) has the molecular formula C29H33N5O and a molecular weight of 467.62 g/mol. Its IUPAC name is 6-methoxy-8-[4-[1-(5-methylquinolin-8-yl)piperidin-4-yl]piperazin-1-yl]quinoline.
| Compound Name | 6-methoxy-8-[4-[1-(5-methylquinolin-8-yl)piperidin-4-yl]piperazin-1-yl]quinoline |
|---|---|
| PubChem CID | 59827333 |
| Molecular Formula | C29H33N5O |
| Molecular Weight | 467.62 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | 6-methoxy-8-[4-[1-(5-methylquinolin-8-yl)piperidin-4-yl]piperazin-1-yl]quinoline |
| SMILES | COc1cc(N2CCN(C3CCN(c4ccc(C)c5cccnc45)CC3)CC2)c2ncccc2c1 |
| InChI | InChI=1S/C29H33N5O/c1-21-7-8-26(29-25(21)6-4-12-31-29)33-13-9-23(10-14-33)32-15-17-34(18-16-32)27-20-24(35-2)19-22-5-3-11-30-28(22)27/h3-8,11-12,19-20,23H,9-10,13-18H2,1-2H3 |
| InChIKey | XSJXMCGZWQDIFS-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.62 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |