C27H28FN5O4S — CID 25028617
[8-[4-[1-(5-fluoroquinolin-8-yl)piperidin-4-yl]piperazin-1-yl]quinolin-6-yl] hydrogen sulfate (PubChem CID 25028617) has the molecular formula C27H28FN5O4S and a molecular weight of 537.62 g/mol. Its IUPAC name is [8-[4-[1-(5-fluoroquinolin-8-yl)piperidin-4-yl]piperazin-1-yl]quinolin-6-yl] hydrogen sulfate.
| Compound Name | [8-[4-[1-(5-fluoroquinolin-8-yl)piperidin-4-yl]piperazin-1-yl]quinolin-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 25028617 |
| Molecular Formula | C27H28FN5O4S |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | [8-[4-[1-(5-fluoroquinolin-8-yl)piperidin-4-yl]piperazin-1-yl]quinolin-6-yl] hydrogen sulfate |
| SMILES | O=S(=O)(O)Oc1cc(N2CCN(C3CCN(c4ccc(F)c5cccnc45)CC3)CC2)c2ncccc2c1 |
| InChI | InChI=1S/C27H28FN5O4S/c28-23-5-6-24(27-22(23)4-2-10-30-27)32-11-7-20(8-12-32)31-13-15-33(16-14-31)25-18-21(37-38(34,35)36)17-19-3-1-9-29-26(19)25/h1-6,9-10,17-18,20H,7-8,11-16H2,(H,34,35,36) |
| InChIKey | DKIZFCUOKCTAJV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|