C21H20Cl2N2O — CID 67275765
7-[4-[(2,4-dichlorophenyl)methyl]piperidin-1-yl]quinolin-8-ol (PubChem CID 67275765) has the molecular formula C21H20Cl2N2O and a molecular weight of 387.31 g/mol. Its IUPAC name is 7-[4-[(2,4-dichlorophenyl)methyl]piperidin-1-yl]quinolin-8-ol.
| Compound Name | 7-[4-[(2,4-dichlorophenyl)methyl]piperidin-1-yl]quinolin-8-ol |
|---|---|
| PubChem CID | 67275765 |
| Molecular Formula | C21H20Cl2N2O |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 7-[4-[(2,4-dichlorophenyl)methyl]piperidin-1-yl]quinolin-8-ol |
| SMILES | Oc1c(N2CCC(Cc3ccc(Cl)cc3Cl)CC2)ccc2cccnc12 |
| InChI | InChI=1S/C21H20Cl2N2O/c22-17-5-3-16(18(23)13-17)12-14-7-10-25(11-8-14)19-6-4-15-2-1-9-24-20(15)21(19)26/h1-6,9,13-14,26H,7-8,10-12H2 |
| InChIKey | CFHZBMHAJXRSQX-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |