C28H30N4O — CID 134268062
2,6-dimethyl-3-[3-methyl-4-[4-(quinolin-8-ylmethyl)piperidin-1-yl]phenyl]pyrimidin-4-one (PubChem CID 134268062) has the molecular formula C28H30N4O and a molecular weight of 438.58 g/mol. Its IUPAC name is 2,6-dimethyl-3-[3-methyl-4-[4-(quinolin-8-ylmethyl)piperidin-1-yl]phenyl]pyrimidin-4-one.
| Compound Name | 2,6-dimethyl-3-[3-methyl-4-[4-(quinolin-8-ylmethyl)piperidin-1-yl]phenyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 134268062 |
| Molecular Formula | C28H30N4O |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 2,6-dimethyl-3-[3-methyl-4-[4-(quinolin-8-ylmethyl)piperidin-1-yl]phenyl]pyrimidin-4-one |
| SMILES | Cc1cc(=O)n(-c2ccc(N3CCC(Cc4cccc5cccnc45)CC3)c(C)c2)c(C)n1 |
| InChI | InChI=1S/C28H30N4O/c1-19-16-25(32-21(3)30-20(2)17-27(32)33)9-10-26(19)31-14-11-22(12-15-31)18-24-7-4-6-23-8-5-13-29-28(23)24/h4-10,13,16-17,22H,11-12,14-15,18H2,1-3H3 |
| InChIKey | GJIJEEVOVYLQJH-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|