C26H27ClN4O — CID 118188312
3-[3-chloro-4-[4-(1H-indol-4-ylmethyl)piperidin-1-yl]phenyl]-2,6-dimethylpyrimidin-4-one (PubChem CID 118188312) has the molecular formula C26H27ClN4O and a molecular weight of 446.98 g/mol. Its IUPAC name is 3-[3-chloro-4-[4-(1H-indol-4-ylmethyl)piperidin-1-yl]phenyl]-2,6-dimethylpyrimidin-4-one.
| Compound Name | 3-[3-chloro-4-[4-(1H-indol-4-ylmethyl)piperidin-1-yl]phenyl]-2,6-dimethylpyrimidin-4-one |
|---|---|
| PubChem CID | 118188312 |
| Molecular Formula | C26H27ClN4O |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 3-[3-chloro-4-[4-(1H-indol-4-ylmethyl)piperidin-1-yl]phenyl]-2,6-dimethylpyrimidin-4-one |
| SMILES | Cc1cc(=O)n(-c2ccc(N3CCC(Cc4cccc5[nH]ccc45)CC3)c(Cl)c2)c(C)n1 |
| InChI | InChI=1S/C26H27ClN4O/c1-17-14-26(32)31(18(2)29-17)21-6-7-25(23(27)16-21)30-12-9-19(10-13-30)15-20-4-3-5-24-22(20)8-11-28-24/h3-8,11,14,16,19,28H,9-10,12-13,15H2,1-2H3 |
| InChIKey | AYVXHUBMYKNEDW-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|