C22H24ClN5O — CID 118188374
3-[3-chloro-4-[4-(pyrazin-2-ylmethyl)piperidin-1-yl]phenyl]-2,6-dimethylpyrimidin-4-one (PubChem CID 118188374) has the molecular formula C22H24ClN5O and a molecular weight of 409.92 g/mol. Its IUPAC name is 3-[3-chloro-4-[4-(pyrazin-2-ylmethyl)piperidin-1-yl]phenyl]-2,6-dimethylpyrimidin-4-one.
| Compound Name | 3-[3-chloro-4-[4-(pyrazin-2-ylmethyl)piperidin-1-yl]phenyl]-2,6-dimethylpyrimidin-4-one |
|---|---|
| PubChem CID | 118188374 |
| Molecular Formula | C22H24ClN5O |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 3-[3-chloro-4-[4-(pyrazin-2-ylmethyl)piperidin-1-yl]phenyl]-2,6-dimethylpyrimidin-4-one |
| SMILES | Cc1cc(=O)n(-c2ccc(N3CCC(Cc4cnccn4)CC3)c(Cl)c2)c(C)n1 |
| InChI | InChI=1S/C22H24ClN5O/c1-15-11-22(29)28(16(2)26-15)19-3-4-21(20(23)13-19)27-9-5-17(6-10-27)12-18-14-24-7-8-25-18/h3-4,7-8,11,13-14,17H,5-6,9-10,12H2,1-2H3 |
| InChIKey | YACWQBDVKJXBQY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|