C29H27ClN4O — CID 118164660
6-[[1-[2-chloro-4-(2,4-dimethyl-6-oxopyrimidin-1-yl)phenyl]piperidin-4-yl]methyl]naphthalene-2-carbonitrile (PubChem CID 118164660) has the molecular formula C29H27ClN4O and a molecular weight of 483.02 g/mol. Its IUPAC name is 6-[[1-[2-chloro-4-(2,4-dimethyl-6-oxopyrimidin-1-yl)phenyl]piperidin-4-yl]methyl]naphthalene-2-carbonitrile.
| Compound Name | 6-[[1-[2-chloro-4-(2,4-dimethyl-6-oxopyrimidin-1-yl)phenyl]piperidin-4-yl]methyl]naphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 118164660 |
| Molecular Formula | C29H27ClN4O |
| Molecular Weight | 483.02 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 6-[[1-[2-chloro-4-(2,4-dimethyl-6-oxopyrimidin-1-yl)phenyl]piperidin-4-yl]methyl]naphthalene-2-carbonitrile |
| SMILES | Cc1cc(=O)n(-c2ccc(N3CCC(Cc4ccc5cc(C#N)ccc5c4)CC3)c(Cl)c2)c(C)n1 |
| InChI | InChI=1S/C29H27ClN4O/c1-19-13-29(35)34(20(2)32-19)26-7-8-28(27(30)17-26)33-11-9-21(10-12-33)14-22-3-5-25-16-23(18-31)4-6-24(25)15-22/h3-8,13,15-17,21H,9-12,14H2,1-2H3 |
| InChIKey | ASDMJTFUUQGPDF-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.02 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|