C26H28ClN3O2 — CID 134285308
3-[3-chloro-4-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperidin-1-yl]phenyl]-2,6-dimethylpyrimidin-4-one (PubChem CID 134285308) has the molecular formula C26H28ClN3O2 and a molecular weight of 449.98 g/mol. Its IUPAC name is 3-[3-chloro-4-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperidin-1-yl]phenyl]-2,6-dimethylpyrimidin-4-one.
| Compound Name | 3-[3-chloro-4-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperidin-1-yl]phenyl]-2,6-dimethylpyrimidin-4-one |
|---|---|
| PubChem CID | 134285308 |
| Molecular Formula | C26H28ClN3O2 |
| Molecular Weight | 449.98 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 3-[3-chloro-4-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperidin-1-yl]phenyl]-2,6-dimethylpyrimidin-4-one |
| SMILES | Cc1cc(=O)n(-c2ccc(N3CCC(Cc4ccc5c(c4)CCO5)CC3)c(Cl)c2)c(C)n1 |
| InChI | InChI=1S/C26H28ClN3O2/c1-17-13-26(31)30(18(2)28-17)22-4-5-24(23(27)16-22)29-10-7-19(8-11-29)14-20-3-6-25-21(15-20)9-12-32-25/h3-6,13,15-16,19H,7-12,14H2,1-2H3 |
| InChIKey | OBTVTCGKKNEGDR-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.98 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|