C22H28ClN3O2 — CID 134268081
3-[3-chloro-4-[4-[[(2R)-oxolan-2-yl]methyl]piperidin-1-yl]phenyl]-2,6-dimethylpyrimidin-4-one (PubChem CID 134268081) has the molecular formula C22H28ClN3O2 and a molecular weight of 401.94 g/mol. Its IUPAC name is 3-[3-chloro-4-[4-[[(2R)-oxolan-2-yl]methyl]piperidin-1-yl]phenyl]-2,6-dimethylpyrimidin-4-one.
| Compound Name | 3-[3-chloro-4-[4-[[(2R)-oxolan-2-yl]methyl]piperidin-1-yl]phenyl]-2,6-dimethylpyrimidin-4-one |
|---|---|
| PubChem CID | 134268081 |
| Molecular Formula | C22H28ClN3O2 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 3-[3-chloro-4-[4-[[(2R)-oxolan-2-yl]methyl]piperidin-1-yl]phenyl]-2,6-dimethylpyrimidin-4-one |
| SMILES | Cc1cc(=O)n(-c2ccc(N3CCC(C[C@H]4CCCO4)CC3)c(Cl)c2)c(C)n1 |
| InChI | InChI=1S/C22H28ClN3O2/c1-15-12-22(27)26(16(2)24-15)18-5-6-21(20(23)14-18)25-9-7-17(8-10-25)13-19-4-3-11-28-19/h5-6,12,14,17,19H,3-4,7-11,13H2,1-2H3/t19-/m1/s1 |
| InChIKey | SODQSVPIHSGPBR-LJQANCHMSA-N |
| XLogP | 4.29 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|