C16H19FN3O3P — CID 123483127
3-[4-(4,4-dihydroxy-1-aza-4λ5-phosphacyclohex-4-en-1-yl)-3-fluorophenyl]-2,6-dimethylpyrimidin-4-one (PubChem CID 123483127) has the molecular formula C16H19FN3O3P and a molecular weight of 351.32 g/mol. Its IUPAC name is 3-[4-(4,4-dihydroxy-1-aza-4λ5-phosphacyclohex-4-en-1-yl)-3-fluorophenyl]-2,6-dimethylpyrimidin-4-one.
| Compound Name | 3-[4-(4,4-dihydroxy-1-aza-4λ5-phosphacyclohex-4-en-1-yl)-3-fluorophenyl]-2,6-dimethylpyrimidin-4-one |
|---|---|
| PubChem CID | 123483127 |
| Molecular Formula | C16H19FN3O3P |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 3-[4-(4,4-dihydroxy-1-aza-4λ5-phosphacyclohex-4-en-1-yl)-3-fluorophenyl]-2,6-dimethylpyrimidin-4-one |
| SMILES | Cc1cc(=O)n(-c2ccc(N3CC=P(O)(O)CC3)c(F)c2)c(C)n1 |
| InChI | InChI=1S/C16H19FN3O3P/c1-11-9-16(21)20(12(2)18-11)13-3-4-15(14(17)10-13)19-5-7-24(22,23)8-6-19/h3-4,7,9-10,22-23H,5-6,8H2,1-2H3 |
| InChIKey | CAJIPCGUHOKSGJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|