C16H19N3O2 — CID 72948579
2,6-dimethyl-3-(3-morpholin-4-ylphenyl)pyrimidin-4-one (PubChem CID 72948579) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 2,6-dimethyl-3-(3-morpholin-4-ylphenyl)pyrimidin-4-one.
| Compound Name | 2,6-dimethyl-3-(3-morpholin-4-ylphenyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 72948579 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2,6-dimethyl-3-(3-morpholin-4-ylphenyl)pyrimidin-4-one |
| SMILES | Cc1cc(=O)n(-c2cccc(N3CCOCC3)c2)c(C)n1 |
| InChI | InChI=1S/C16H19N3O2/c1-12-10-16(20)19(13(2)17-12)15-5-3-4-14(11-15)18-6-8-21-9-7-18/h3-5,10-11H,6-9H2,1-2H3 |
| InChIKey | OMXYZBBOMMHAFG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |