C23H24ClFN4O — CID 118164662
3-[3-chloro-4-[4-(3-fluoroanilino)piperidin-1-yl]phenyl]-2,6-dimethylpyrimidin-4-one (PubChem CID 118164662) has the molecular formula C23H24ClFN4O and a molecular weight of 426.92 g/mol. Its IUPAC name is 3-[3-chloro-4-[4-(3-fluoroanilino)piperidin-1-yl]phenyl]-2,6-dimethylpyrimidin-4-one.
| Compound Name | 3-[3-chloro-4-[4-(3-fluoroanilino)piperidin-1-yl]phenyl]-2,6-dimethylpyrimidin-4-one |
|---|---|
| PubChem CID | 118164662 |
| Molecular Formula | C23H24ClFN4O |
| Molecular Weight | 426.92 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 3-[3-chloro-4-[4-(3-fluoroanilino)piperidin-1-yl]phenyl]-2,6-dimethylpyrimidin-4-one |
| SMILES | Cc1cc(=O)n(-c2ccc(N3CCC(Nc4cccc(F)c4)CC3)c(Cl)c2)c(C)n1 |
| InChI | InChI=1S/C23H24ClFN4O/c1-15-12-23(30)29(16(2)26-15)20-6-7-22(21(24)14-20)28-10-8-18(9-11-28)27-19-5-3-4-17(25)13-19/h3-7,12-14,18,27H,8-11H2,1-2H3 |
| InChIKey | WDJXXAKJHNTIQC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.92 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|