C24H27ClFN3 — CID 151399914
1-[3-chloro-4-[4-[(2-fluorophenyl)methyl]piperidin-1-yl]phenyl]-2,4-dimethyl-2H-pyrimidine (PubChem CID 151399914) has the molecular formula C24H27ClFN3 and a molecular weight of 411.95 g/mol. Its IUPAC name is 1-[3-chloro-4-[4-[(2-fluorophenyl)methyl]piperidin-1-yl]phenyl]-2,4-dimethyl-2H-pyrimidine.
| Compound Name | 1-[3-chloro-4-[4-[(2-fluorophenyl)methyl]piperidin-1-yl]phenyl]-2,4-dimethyl-2H-pyrimidine |
|---|---|
| PubChem CID | 151399914 |
| Molecular Formula | C24H27ClFN3 |
| Molecular Weight | 411.95 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 1-[3-chloro-4-[4-[(2-fluorophenyl)methyl]piperidin-1-yl]phenyl]-2,4-dimethyl-2H-pyrimidine |
| SMILES | CC1=NC(C)N(c2ccc(N3CCC(Cc4ccccc4F)CC3)c(Cl)c2)C=C1 |
| InChI | InChI=1S/C24H27ClFN3/c1-17-9-14-29(18(2)27-17)21-7-8-24(22(25)16-21)28-12-10-19(11-13-28)15-20-5-3-4-6-23(20)26/h3-9,14,16,18-19H,10-13,15H2,1-2H3 |
| InChIKey | OWGLFYVIPAPXMX-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.95 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|