C21H26N4O3 — CID 59829111
(4R)-1-(4-aminophenyl)-7,8-dimethoxy-N,N,4-trimethyl-4,5-dihydro-2,3-benzodiazepine-3-carboxamide (PubChem CID 59829111) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is (4R)-1-(4-aminophenyl)-7,8-dimethoxy-N,N,4-trimethyl-4,5-dihydro-2,3-benzodiazepine-3-carboxamide.
| Compound Name | (4R)-1-(4-aminophenyl)-7,8-dimethoxy-N,N,4-trimethyl-4,5-dihydro-2,3-benzodiazepine-3-carboxamide |
|---|---|
| PubChem CID | 59829111 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (4R)-1-(4-aminophenyl)-7,8-dimethoxy-N,N,4-trimethyl-4,5-dihydro-2,3-benzodiazepine-3-carboxamide |
| SMILES | COc1cc2c(cc1OC)C(c1ccc(N)cc1)=NN(C(=O)N(C)C)[C@H](C)C2 |
| InChI | InChI=1S/C21H26N4O3/c1-13-10-15-11-18(27-4)19(28-5)12-17(15)20(14-6-8-16(22)9-7-14)23-25(13)21(26)24(2)3/h6-9,11-13H,10,22H2,1-5H3/t13-/m1/s1 |
| InChIKey | BDEBOMHGJWQUHY-CYBMUJFWSA-N |
| XLogP | 2.97 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|