C19H19Cl2N3O2 — CID 18975192
ethyl 1-(4-aminophenyl)-7,8-dichloro-4-methyl-4,5-dihydro-2,3-benzodiazepine-3-carboxylate (PubChem CID 18975192) has the molecular formula C19H19Cl2N3O2 and a molecular weight of 392.29 g/mol. Its IUPAC name is ethyl 1-(4-aminophenyl)-7,8-dichloro-4-methyl-4,5-dihydro-2,3-benzodiazepine-3-carboxylate.
| Compound Name | ethyl 1-(4-aminophenyl)-7,8-dichloro-4-methyl-4,5-dihydro-2,3-benzodiazepine-3-carboxylate |
|---|---|
| PubChem CID | 18975192 |
| Molecular Formula | C19H19Cl2N3O2 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | ethyl 1-(4-aminophenyl)-7,8-dichloro-4-methyl-4,5-dihydro-2,3-benzodiazepine-3-carboxylate |
| SMILES | CCOC(=O)N1N=C(c2ccc(N)cc2)c2cc(Cl)c(Cl)cc2CC1C |
| InChI | InChI=1S/C19H19Cl2N3O2/c1-3-26-19(25)24-11(2)8-13-9-16(20)17(21)10-15(13)18(23-24)12-4-6-14(22)7-5-12/h4-7,9-11H,3,8,22H2,1-2H3 |
| InChIKey | CSIWHAWYQRGMDG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|