C30H33N5O2 — CID 59830862
1-[2-[2-(2-ethylphenyl)-5-methylpyrazol-3-yl]oxyphenyl]-3-(4-piperidin-1-ylphenyl)urea (PubChem CID 59830862) has the molecular formula C30H33N5O2 and a molecular weight of 495.63 g/mol. Its IUPAC name is 1-[2-[2-(2-ethylphenyl)-5-methylpyrazol-3-yl]oxyphenyl]-3-(4-piperidin-1-ylphenyl)urea.
| Compound Name | 1-[2-[2-(2-ethylphenyl)-5-methylpyrazol-3-yl]oxyphenyl]-3-(4-piperidin-1-ylphenyl)urea |
|---|---|
| PubChem CID | 59830862 |
| Molecular Formula | C30H33N5O2 |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | 1-[2-[2-(2-ethylphenyl)-5-methylpyrazol-3-yl]oxyphenyl]-3-(4-piperidin-1-ylphenyl)urea |
| SMILES | CCc1ccccc1-n1nc(C)cc1Oc1ccccc1NC(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C30H33N5O2/c1-3-23-11-5-7-13-27(23)35-29(21-22(2)33-35)37-28-14-8-6-12-26(28)32-30(36)31-24-15-17-25(18-16-24)34-19-9-4-10-20-34/h5-8,11-18,21H,3-4,9-10,19-20H2,1-2H3,(H2,31,32,36) |
| InChIKey | ANODRPTYUXHTBN-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|