C28H39F2N3O5 — CID 59833015
4-[2-[[(2S)-2-[[(2S)-6,6-dimethyl-3-[(2S)-2,3,3-trimethylbutanoyl]-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-4,4-difluorobutanoyl]amino]ethyl]benzoic acid (PubChem CID 59833015) has the molecular formula C28H39F2N3O5 and a molecular weight of 535.63 g/mol. Its IUPAC name is 4-[2-[[(2S)-2-[[(2S)-6,6-dimethyl-3-[(2S)-2,3,3-trimethylbutanoyl]-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-4,4-difluorobutanoyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[2-[[(2S)-2-[[(2S)-6,6-dimethyl-3-[(2S)-2,3,3-trimethylbutanoyl]-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-4,4-difluorobutanoyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 59833015 |
| Molecular Formula | C28H39F2N3O5 |
| Molecular Weight | 535.63 g/mol |
| Exact Mass | 535.29 |
| IUPAC Name | 4-[2-[[(2S)-2-[[(2S)-6,6-dimethyl-3-[(2S)-2,3,3-trimethylbutanoyl]-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-4,4-difluorobutanoyl]amino]ethyl]benzoic acid |
| SMILES | C[C@H](C(=O)N1CC2C([C@H]1C(=O)N[C@@H](CC(F)F)C(=O)NCCc1ccc(C(=O)O)cc1)C2(C)C)C(C)(C)C |
| InChI | InChI=1S/C28H39F2N3O5/c1-15(27(2,3)4)25(36)33-14-18-21(28(18,5)6)22(33)24(35)32-19(13-20(29)30)23(34)31-12-11-16-7-9-17(10-8-16)26(37)38/h7-10,15,18-22H,11-14H2,1-6H3,(H,31,34)(H,32,35)(H,37,38)/t15-,18?,19+,21?,22+/m1/s1 |
| InChIKey | QNOKCFOHPXWQJZ-UWZKFKONSA-N |
| XLogP | 3.35 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.63 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |