C23H34N2O2 — CID 170631717
(1R,2S,5S)-6,6-dimethyl-N-(2-phenylethyl)-3-[(2S)-2,3,3-trimethylbutanoyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 170631717) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is (1R,2S,5S)-6,6-dimethyl-N-(2-phenylethyl)-3-[(2S)-2,3,3-trimethylbutanoyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-6,6-dimethyl-N-(2-phenylethyl)-3-[(2S)-2,3,3-trimethylbutanoyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 170631717 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | (1R,2S,5S)-6,6-dimethyl-N-(2-phenylethyl)-3-[(2S)-2,3,3-trimethylbutanoyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | C[C@H](C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)NCCc1ccccc1)C2(C)C)C(C)(C)C |
| InChI | InChI=1S/C23H34N2O2/c1-15(22(2,3)4)21(27)25-14-17-18(23(17,5)6)19(25)20(26)24-13-12-16-10-8-7-9-11-16/h7-11,15,17-19H,12-14H2,1-6H3,(H,24,26)/t15-,17+,18+,19+/m1/s1 |
| InChIKey | YZDITMGMOMBAQU-BVBHFADKSA-N |
| XLogP | 3.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |