About 6-(2,4-difluorophenoxy)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine
6-(2,4-difluorophenoxy)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine (PubChem CID 59834415) has the molecular formula C20H15F2N3O2
and a molecular weight of 367.36 g/mol. Its IUPAC name is 6-(2,4-difluorophenoxy)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine.
Molecular Properties
| Compound Name | 6-(2,4-difluorophenoxy)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine |
| PubChem CID | 59834415 |
| Molecular Formula | C20H15F2N3O2 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 6-(2,4-difluorophenoxy)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine |
| SMILES | CCOc1ccccc1-c1[nH]nc2nc(Oc3ccc(F)cc3F)ccc12 |
| InChI | InChI=1S/C20H15F2N3O2/c1-2-26-16-6-4-3-5-13(16)19-14-8-10-18(23-20(14)25-24-19)27-17-9-7-12(21)11-15(17)22/h3-11H,2H2,1H3,(H,23,24,25) |
| InChIKey | XBEVJGBTSVOOGH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(2,4-difluorophenoxy)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,4-difluorophenoxy)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine?
The IUPAC name of 6-(2,4-difluorophenoxy)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine (CID 59834415) is 6-(2,4-difluorophenoxy)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine.
What is the SMILES notation for 6-(2,4-difluorophenoxy)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine?
The canonical SMILES for 6-(2,4-difluorophenoxy)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine is CCOc1ccccc1-c1[nH]nc2nc(Oc3ccc(F)cc3F)ccc12.
What is the InChIKey of 6-(2,4-difluorophenoxy)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine?
The InChIKey is XBEVJGBTSVOOGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15F2N3O2/c1-2-26-16-6-4-3-5-13(16)19-14-8-10-18(23-20(14)25-24-19)27-17-9-7-12(21)11-15(17)22/h3-11H,2H2,1H3,(H,23,24,25).
What are the key properties of 6-(2,4-difluorophenoxy)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine?
6-(2,4-difluorophenoxy)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine has a molecular weight of 367.36 g/mol, XLogP of 5.09, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,4-difluorophenoxy)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine is sourced from PubChem (CID 59834415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).