C22H27N3O — CID 59835682
N,17-diethyl-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4,6,8,16-pentaene-1-carboxamide (PubChem CID 59835682) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is N,17-diethyl-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4,6,8,16-pentaene-1-carboxamide.
| Compound Name | N,17-diethyl-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4,6,8,16-pentaene-1-carboxamide |
|---|---|
| PubChem CID | 59835682 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | N,17-diethyl-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4,6,8,16-pentaene-1-carboxamide |
| SMILES | CCNC(=O)C12CC3C=C(CC)C1N(CCc1c2[nH]c2ccccc12)C3 |
| InChI | InChI=1S/C22H27N3O/c1-3-15-11-14-12-22(21(26)23-4-2)19-17(9-10-25(13-14)20(15)22)16-7-5-6-8-18(16)24-19/h5-8,11,14,20,24H,3-4,9-10,12-13H2,1-2H3,(H,23,26) |
| InChIKey | DLBDRFRVAYEXQO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|