C30H30ClN3 — CID 59835856
N-[2-[5-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]indol-1-yl]ethyl]-N-(cyclopropylmethyl)propan-1-amine (PubChem CID 59835856) has the molecular formula C30H30ClN3 and a molecular weight of 468.04 g/mol. Its IUPAC name is N-[2-[5-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]indol-1-yl]ethyl]-N-(cyclopropylmethyl)propan-1-amine.
| Compound Name | N-[2-[5-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]indol-1-yl]ethyl]-N-(cyclopropylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 59835856 |
| Molecular Formula | C30H30ClN3 |
| Molecular Weight | 468.04 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | N-[2-[5-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]indol-1-yl]ethyl]-N-(cyclopropylmethyl)propan-1-amine |
| SMILES | CCCN(CCn1ccc2cc(C#Cc3ccc(-c4ccc(Cl)cc4)cn3)ccc21)CC1CC1 |
| InChI | InChI=1S/C30H30ClN3/c1-2-16-33(22-24-3-4-24)18-19-34-17-15-26-20-23(6-14-30(26)34)5-12-29-13-9-27(21-32-29)25-7-10-28(31)11-8-25/h6-11,13-15,17,20-21,24H,2-4,16,18-19,22H2,1H3 |
| InChIKey | NQLONLRKTQRXMT-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.04 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|