C27H24ClN3O — CID 69072598
1-[2-[5-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]indol-1-yl]ethyl]pyrrolidin-3-ol (PubChem CID 69072598) has the molecular formula C27H24ClN3O and a molecular weight of 441.96 g/mol. Its IUPAC name is 1-[2-[5-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]indol-1-yl]ethyl]pyrrolidin-3-ol.
| Compound Name | 1-[2-[5-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]indol-1-yl]ethyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 69072598 |
| Molecular Formula | C27H24ClN3O |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 1-[2-[5-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]indol-1-yl]ethyl]pyrrolidin-3-ol |
| SMILES | OC1CCN(CCn2ccc3cc(C#Cc4ccc(-c5ccc(Cl)cc5)cn4)ccc32)C1 |
| InChI | InChI=1S/C27H24ClN3O/c28-24-6-3-21(4-7-24)23-5-9-25(29-18-23)8-1-20-2-10-27-22(17-20)11-14-31(27)16-15-30-13-12-26(32)19-30/h2-7,9-11,14,17-18,26,32H,12-13,15-16,19H2 |
| InChIKey | KDEQUPFCFPKNGJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|