C13H14N2 — CID 59837844
9,13-diazatetracyclo[9.3.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraene (PubChem CID 59837844) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 9,13-diazatetracyclo[9.3.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraene.
| Compound Name | 9,13-diazatetracyclo[9.3.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraene |
|---|---|
| PubChem CID | 59837844 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 9,13-diazatetracyclo[9.3.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraene |
| SMILES | c1ccc2c3c([nH]c2c1)C1CNCC3C1 |
| InChI | InChI=1S/C13H14N2/c1-2-4-11-10(3-1)12-8-5-9(7-14-6-8)13(12)15-11/h1-4,8-9,14-15H,5-7H2 |
| InChIKey | GXPJGZDSTMUJBN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|