C8H10NOY- — CID 59839387
4-amino-2,6-dimethylbenzene-5-id-1-ol;yttrium (PubChem CID 59839387) has the molecular formula C8H10NOY- and a molecular weight of 225.08 g/mol. Its IUPAC name is 4-amino-2,6-dimethylbenzene-5-id-1-ol;yttrium.
| Compound Name | 4-amino-2,6-dimethylbenzene-5-id-1-ol;yttrium |
|---|---|
| PubChem CID | 59839387 |
| Molecular Formula | C8H10NOY- |
| Molecular Weight | 225.08 g/mol |
| Exact Mass | 224.98 |
| IUPAC Name | 4-amino-2,6-dimethylbenzene-5-id-1-ol;yttrium |
| SMILES | Cc1[c-]c(N)cc(C)c1O.[Y] |
| InChI | InChI=1S/C8H10NO.Y/c1-5-3-7(9)4-6(2)8(5)10;/h3,10H,9H2,1-2H3;/q-1; |
| InChIKey | QCOGBOBPPMSGEV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.08 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|