C9H12NOY- — CID 59973165
2-amino-3,4,6-trimethylbenzene-5-id-1-ol;yttrium (PubChem CID 59973165) has the molecular formula C9H12NOY- and a molecular weight of 239.11 g/mol. Its IUPAC name is 2-amino-3,4,6-trimethylbenzene-5-id-1-ol;yttrium.
| Compound Name | 2-amino-3,4,6-trimethylbenzene-5-id-1-ol;yttrium |
|---|---|
| PubChem CID | 59973165 |
| Molecular Formula | C9H12NOY- |
| Molecular Weight | 239.11 g/mol |
| Exact Mass | 239.00 |
| IUPAC Name | 2-amino-3,4,6-trimethylbenzene-5-id-1-ol;yttrium |
| SMILES | Cc1[c-]c(C)c(O)c(N)c1C.[Y] |
| InChI | InChI=1S/C9H12NO.Y/c1-5-4-6(2)9(11)8(10)7(5)3;/h11H,10H2,1-3H3;/q-1; |
| InChIKey | SGAZPXARNAXEAI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.11 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|