C8H15NO — CID 142347493
6-aminocyclohexa-1,5-dien-1-ol;ethane (PubChem CID 142347493) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is 6-aminocyclohexa-1,5-dien-1-ol;ethane.
| Compound Name | 6-aminocyclohexa-1,5-dien-1-ol;ethane |
|---|---|
| PubChem CID | 142347493 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 6-aminocyclohexa-1,5-dien-1-ol;ethane |
| SMILES | CC.NC1=CCCC=C1O |
| InChI | InChI=1S/C6H9NO.C2H6/c7-5-3-1-2-4-6(5)8;1-2/h3-4,8H,1-2,7H2;1-2H3 |
| InChIKey | SRODRNWMSCELJW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |