C5H7NO — CID 54193764
5-aminocyclopenta-1,4-dien-1-ol (PubChem CID 54193764) has the molecular formula C5H7NO and a molecular weight of 97.12 g/mol. Its IUPAC name is 5-aminocyclopenta-1,4-dien-1-ol.
| Compound Name | 5-aminocyclopenta-1,4-dien-1-ol |
|---|---|
| PubChem CID | 54193764 |
| Molecular Formula | C5H7NO |
| Molecular Weight | 97.12 g/mol |
| Exact Mass | 97.05 |
| IUPAC Name | 5-aminocyclopenta-1,4-dien-1-ol |
| SMILES | NC1=CCC=C1O |
| InChI | InChI=1S/C5H7NO/c6-4-2-1-3-5(4)7/h2-3,7H,1,6H2 |
| InChIKey | PKIAVHZRHZWMLK-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 97.12 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |