C25H33N3O3 — CID 59840403
5-(4-acetyl-1,4-diazepan-1-yl)-N-[4-(3-methoxyphenyl)phenyl]pentanamide (PubChem CID 59840403) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is 5-(4-acetyl-1,4-diazepan-1-yl)-N-[4-(3-methoxyphenyl)phenyl]pentanamide.
| Compound Name | 5-(4-acetyl-1,4-diazepan-1-yl)-N-[4-(3-methoxyphenyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 59840403 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 5-(4-acetyl-1,4-diazepan-1-yl)-N-[4-(3-methoxyphenyl)phenyl]pentanamide |
| SMILES | COc1cccc(-c2ccc(NC(=O)CCCCN3CCCN(C(C)=O)CC3)cc2)c1 |
| InChI | InChI=1S/C25H33N3O3/c1-20(29)28-16-6-15-27(17-18-28)14-4-3-9-25(30)26-23-12-10-21(11-13-23)22-7-5-8-24(19-22)31-2/h5,7-8,10-13,19H,3-4,6,9,14-18H2,1-2H3,(H,26,30) |
| InChIKey | NDBNOXYDEZQNOE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|