C26H35N3O4 — CID 59840877
N-[(2S)-2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-4-methylpentyl]-N-phenylmethoxyformamide (PubChem CID 59840877) has the molecular formula C26H35N3O4 and a molecular weight of 453.58 g/mol. Its IUPAC name is N-[(2S)-2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-4-methylpentyl]-N-phenylmethoxyformamide.
| Compound Name | N-[(2S)-2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-4-methylpentyl]-N-phenylmethoxyformamide |
|---|---|
| PubChem CID | 59840877 |
| Molecular Formula | C26H35N3O4 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | N-[(2S)-2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-4-methylpentyl]-N-phenylmethoxyformamide |
| SMILES | COc1ccc(N2CCN(C(=O)[C@@H](CC(C)C)CN(C=O)OCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H35N3O4/c1-21(2)17-23(18-29(20-30)33-19-22-7-5-4-6-8-22)26(31)28-15-13-27(14-16-28)24-9-11-25(32-3)12-10-24/h4-12,20-21,23H,13-19H2,1-3H3/t23-/m0/s1 |
| InChIKey | IYNADTDRTWJVAB-QHCPKHFHSA-N |
| XLogP | 3.60 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|