About N,N'-bis(2-morpholin-4-ylethyl)-N'-[3-(2-morpholin-4-ylethylamino)propyl]propane-1,3-diamine
N,N'-bis(2-morpholin-4-ylethyl)-N'-[3-(2-morpholin-4-ylethylamino)propyl]propane-1,3-diamine (PubChem CID 59841341) has the molecular formula C24H50N6O3
and a molecular weight of 470.70 g/mol. Its IUPAC name is N,N'-bis(2-morpholin-4-ylethyl)-N'-[3-(2-morpholin-4-ylethylamino)propyl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N,N'-bis(2-morpholin-4-ylethyl)-N'-[3-(2-morpholin-4-ylethylamino)propyl]propane-1,3-diamine |
| PubChem CID | 59841341 |
| Molecular Formula | C24H50N6O3 |
| Molecular Weight | 470.70 g/mol |
| Exact Mass | 470.39 |
| IUPAC Name | N,N'-bis(2-morpholin-4-ylethyl)-N'-[3-(2-morpholin-4-ylethylamino)propyl]propane-1,3-diamine |
| SMILES | C(CNCCN1CCOCC1)CN(CCCNCCN1CCOCC1)CCN1CCOCC1 |
| InChI | InChI=1S/C24H50N6O3/c1(3-25-5-9-28-13-19-31-20-14-28)7-27(11-12-30-17-23-33-24-18-30)8-2-4-26-6-10-29-15-21-32-22-16-29/h25-26H,1-24H2 |
| InChIKey | DUZSXWMONFYRSW-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.70 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis(2-morpholin-4-ylethyl)-N'-[3-(2-morpholin-4-ylethylamino)propyl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(2-morpholin-4-ylethyl)-N'-[3-(2-morpholin-4-ylethylamino)propyl]propane-1,3-diamine?
The IUPAC name of N,N'-bis(2-morpholin-4-ylethyl)-N'-[3-(2-morpholin-4-ylethylamino)propyl]propane-1,3-diamine (CID 59841341) is N,N'-bis(2-morpholin-4-ylethyl)-N'-[3-(2-morpholin-4-ylethylamino)propyl]propane-1,3-diamine.
What is the SMILES notation for N,N'-bis(2-morpholin-4-ylethyl)-N'-[3-(2-morpholin-4-ylethylamino)propyl]propane-1,3-diamine?
The canonical SMILES for N,N'-bis(2-morpholin-4-ylethyl)-N'-[3-(2-morpholin-4-ylethylamino)propyl]propane-1,3-diamine is C(CNCCN1CCOCC1)CN(CCCNCCN1CCOCC1)CCN1CCOCC1.
What is the InChIKey of N,N'-bis(2-morpholin-4-ylethyl)-N'-[3-(2-morpholin-4-ylethylamino)propyl]propane-1,3-diamine?
The InChIKey is DUZSXWMONFYRSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H50N6O3/c1(3-25-5-9-28-13-19-31-20-14-28)7-27(11-12-30-17-23-33-24-18-30)8-2-4-26-6-10-29-15-21-32-22-16-29/h25-26H,1-24H2.
What are the key properties of N,N'-bis(2-morpholin-4-ylethyl)-N'-[3-(2-morpholin-4-ylethylamino)propyl]propane-1,3-diamine?
N,N'-bis(2-morpholin-4-ylethyl)-N'-[3-(2-morpholin-4-ylethylamino)propyl]propane-1,3-diamine has a molecular weight of 470.70 g/mol, XLogP of -0.76, 17 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(2-morpholin-4-ylethyl)-N'-[3-(2-morpholin-4-ylethylamino)propyl]propane-1,3-diamine is sourced from PubChem (CID 59841341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).