C20H42N6O3 — CID 67951217
1-[2-[1,1-bis(2-piperazin-1-ylethoxy)ethoxy]ethyl]piperazine (PubChem CID 67951217) has the molecular formula C20H42N6O3 and a molecular weight of 414.60 g/mol. Its IUPAC name is 1-[2-[1,1-bis(2-piperazin-1-ylethoxy)ethoxy]ethyl]piperazine.
| Compound Name | 1-[2-[1,1-bis(2-piperazin-1-ylethoxy)ethoxy]ethyl]piperazine |
|---|---|
| PubChem CID | 67951217 |
| Molecular Formula | C20H42N6O3 |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.33 |
| IUPAC Name | 1-[2-[1,1-bis(2-piperazin-1-ylethoxy)ethoxy]ethyl]piperazine |
| SMILES | CC(OCCN1CCNCC1)(OCCN1CCNCC1)OCCN1CCNCC1 |
| InChI | InChI=1S/C20H42N6O3/c1-20(27-17-14-24-8-2-21-3-9-24,28-18-15-25-10-4-22-5-11-25)29-19-16-26-12-6-23-7-13-26/h21-23H,2-19H2,1H3 |
| InChIKey | ORXVUOPTJRDWKX-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|