C15H28O3 — CID 59841793
(Z)-11-(2-methyl-1,3-dioxolan-2-yl)undec-5-en-1-ol (PubChem CID 59841793) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is (Z)-11-(2-methyl-1,3-dioxolan-2-yl)undec-5-en-1-ol.
| Compound Name | (Z)-11-(2-methyl-1,3-dioxolan-2-yl)undec-5-en-1-ol |
|---|---|
| PubChem CID | 59841793 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | (Z)-11-(2-methyl-1,3-dioxolan-2-yl)undec-5-en-1-ol |
| SMILES | CC1(CCCCC/C=C\CCCCO)OCCO1 |
| InChI | InChI=1S/C15H28O3/c1-15(17-13-14-18-15)11-9-7-5-3-2-4-6-8-10-12-16/h2,4,16H,3,5-14H2,1H3/b4-2- |
| InChIKey | KJCMFTMZXUNTOU-RQOWECAXSA-N |
| XLogP | 3.42 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|