C24H19N3O3 — CID 59843024
5-(4-isocyanophenyl)-1-[2-(7-methoxyquinolin-4-yl)oxyethyl]pyridin-2-one (PubChem CID 59843024) has the molecular formula C24H19N3O3 and a molecular weight of 397.43 g/mol. Its IUPAC name is 5-(4-isocyanophenyl)-1-[2-(7-methoxyquinolin-4-yl)oxyethyl]pyridin-2-one.
| Compound Name | 5-(4-isocyanophenyl)-1-[2-(7-methoxyquinolin-4-yl)oxyethyl]pyridin-2-one |
|---|---|
| PubChem CID | 59843024 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 5-(4-isocyanophenyl)-1-[2-(7-methoxyquinolin-4-yl)oxyethyl]pyridin-2-one |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(=O)n(CCOc3ccnc4cc(OC)ccc34)c2)cc1 |
| InChI | InChI=1S/C24H19N3O3/c1-25-19-6-3-17(4-7-19)18-5-10-24(28)27(16-18)13-14-30-23-11-12-26-22-15-20(29-2)8-9-21(22)23/h3-12,15-16H,13-14H2,2H3 |
| InChIKey | RVUHDSPXHMRNLV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 57.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|