C24H25N3O2 — CID 91597127
5-[1-[2-(7-methoxyquinolin-4-yl)oxyethyl]-2H-pyridin-3-yl]-2-methylaniline (PubChem CID 91597127) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 5-[1-[2-(7-methoxyquinolin-4-yl)oxyethyl]-2H-pyridin-3-yl]-2-methylaniline.
| Compound Name | 5-[1-[2-(7-methoxyquinolin-4-yl)oxyethyl]-2H-pyridin-3-yl]-2-methylaniline |
|---|---|
| PubChem CID | 91597127 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 5-[1-[2-(7-methoxyquinolin-4-yl)oxyethyl]-2H-pyridin-3-yl]-2-methylaniline |
| SMILES | COc1ccc2c(OCCN3C=CC=C(c4ccc(C)c(N)c4)C3)ccnc2c1 |
| InChI | InChI=1S/C24H25N3O2/c1-17-5-6-18(14-22(17)25)19-4-3-11-27(16-19)12-13-29-24-9-10-26-23-15-20(28-2)7-8-21(23)24/h3-11,14-15H,12-13,16,25H2,1-2H3 |
| InChIKey | LVPUWWJUVBIJEE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|