C19H27IrN2O2- — CID 59844775
5,5-dimethylhexane-2,4-diol;iridium;2-methyl-3-phenylpyrazine (PubChem CID 59844775) has the molecular formula C19H27IrN2O2- and a molecular weight of 507.65 g/mol. Its IUPAC name is 5,5-dimethylhexane-2,4-diol;iridium;2-methyl-3-phenylpyrazine.
| Compound Name | 5,5-dimethylhexane-2,4-diol;iridium;2-methyl-3-phenylpyrazine |
|---|---|
| PubChem CID | 59844775 |
| Molecular Formula | C19H27IrN2O2- |
| Molecular Weight | 507.65 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | 5,5-dimethylhexane-2,4-diol;iridium;2-methyl-3-phenylpyrazine |
| SMILES | CC(O)CC(O)C(C)(C)C.Cc1nccnc1-c1[c-]cccc1.[Ir] |
| InChI | InChI=1S/C11H9N2.C8H18O2.Ir/c1-9-11(13-8-7-12-9)10-5-3-2-4-6-10;1-6(9)5-7(10)8(2,3)4;/h2-5,7-8H,1H3;6-7,9-10H,5H2,1-4H3;/q-1;; |
| InChIKey | MYAHKPVWYRSPCC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.65 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|