C20H21ClO4 — CID 59846848
ethyl 2-[3-[1-(4-chlorophenyl)-3-oxobutan-2-yl]phenoxy]acetate (PubChem CID 59846848) has the molecular formula C20H21ClO4 and a molecular weight of 360.84 g/mol. Its IUPAC name is ethyl 2-[3-[1-(4-chlorophenyl)-3-oxobutan-2-yl]phenoxy]acetate.
| Compound Name | ethyl 2-[3-[1-(4-chlorophenyl)-3-oxobutan-2-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 59846848 |
| Molecular Formula | C20H21ClO4 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | ethyl 2-[3-[1-(4-chlorophenyl)-3-oxobutan-2-yl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cccc(C(Cc2ccc(Cl)cc2)C(C)=O)c1 |
| InChI | InChI=1S/C20H21ClO4/c1-3-24-20(23)13-25-18-6-4-5-16(12-18)19(14(2)22)11-15-7-9-17(21)10-8-15/h4-10,12,19H,3,11,13H2,1-2H3 |
| InChIKey | DZKVOXCDQKUQSP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |