C16H24FN — CID 59848743
1-(2,2-dimethylpropyl)-3-(4-fluorophenyl)piperidine (PubChem CID 59848743) has the molecular formula C16H24FN and a molecular weight of 249.37 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-3-(4-fluorophenyl)piperidine.
| Compound Name | 1-(2,2-dimethylpropyl)-3-(4-fluorophenyl)piperidine |
|---|---|
| PubChem CID | 59848743 |
| Molecular Formula | C16H24FN |
| Molecular Weight | 249.37 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-3-(4-fluorophenyl)piperidine |
| SMILES | CC(C)(C)CN1CCCC(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C16H24FN/c1-16(2,3)12-18-10-4-5-14(11-18)13-6-8-15(17)9-7-13/h6-9,14H,4-5,10-12H2,1-3H3 |
| InChIKey | OIJUQNNIRWRVDN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |