C12H20N2 — CID 59849275
N'-[4-(2-methylpropyl)phenyl]ethane-1,2-diamine (PubChem CID 59849275) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is N'-[4-(2-methylpropyl)phenyl]ethane-1,2-diamine.
| Compound Name | N'-[4-(2-methylpropyl)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 59849275 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N'-[4-(2-methylpropyl)phenyl]ethane-1,2-diamine |
| SMILES | CC(C)Cc1ccc(NCCN)cc1 |
| InChI | InChI=1S/C12H20N2/c1-10(2)9-11-3-5-12(6-4-11)14-8-7-13/h3-6,10,14H,7-9,13H2,1-2H3 |
| InChIKey | LXDGOWLJZDWDFW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |