About 4,4-dimethylpent-1-en-2-yl(methyl)azanide;rhodium
4,4-dimethylpent-1-en-2-yl(methyl)azanide;rhodium (PubChem CID 59850103) has the molecular formula C8H16NRh-
and a molecular weight of 229.13 g/mol. Its IUPAC name is 4,4-dimethylpent-1-en-2-yl(methyl)azanide;rhodium.
Analyze 4,4-dimethylpent-1-en-2-yl(methyl)azanide;rhodium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethylpent-1-en-2-yl(methyl)azanide;rhodium?
The IUPAC name of 4,4-dimethylpent-1-en-2-yl(methyl)azanide;rhodium (CID 59850103) is 4,4-dimethylpent-1-en-2-yl(methyl)azanide;rhodium.
What is the SMILES notation for 4,4-dimethylpent-1-en-2-yl(methyl)azanide;rhodium?
The canonical SMILES for 4,4-dimethylpent-1-en-2-yl(methyl)azanide;rhodium is C=C(CC(C)(C)C)[N-]C.[Rh].
What is the InChIKey of 4,4-dimethylpent-1-en-2-yl(methyl)azanide;rhodium?
The InChIKey is IDVDTJPUNAUNBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N.Rh/c1-7(9-5)6-8(2,3)4;/h1,6H2,2-5H3;/q-1;.
What are the key properties of 4,4-dimethylpent-1-en-2-yl(methyl)azanide;rhodium?
4,4-dimethylpent-1-en-2-yl(methyl)azanide;rhodium has a molecular weight of 229.13 g/mol, XLogP of 2.94, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethylpent-1-en-2-yl(methyl)azanide;rhodium is sourced from PubChem (CID 59850103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).