About [(1S)-1-phenylpropyl] 3-(azidomethyl)-2-phenylquinoline-4-carboxylate
[(1S)-1-phenylpropyl] 3-(azidomethyl)-2-phenylquinoline-4-carboxylate (PubChem CID 59850127) has the molecular formula C26H22N4O2
and a molecular weight of 422.49 g/mol. Its IUPAC name is [(1S)-1-phenylpropyl] 3-(azidomethyl)-2-phenylquinoline-4-carboxylate.
Molecular Properties
| Compound Name | [(1S)-1-phenylpropyl] 3-(azidomethyl)-2-phenylquinoline-4-carboxylate |
| PubChem CID | 59850127 |
| Molecular Formula | C26H22N4O2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | [(1S)-1-phenylpropyl] 3-(azidomethyl)-2-phenylquinoline-4-carboxylate |
| SMILES | CC[C@H](OC(=O)c1c(CN=[N+]=[N-])c(-c2ccccc2)nc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C26H22N4O2/c1-2-23(18-11-5-3-6-12-18)32-26(31)24-20-15-9-10-16-22(20)29-25(21(24)17-28-30-27)19-13-7-4-8-14-19/h3-16,23H,2,17H2,1H3/t23-/m0/s1 |
| InChIKey | QLQPVMGBAWISLQ-QHCPKHFHSA-N |
| XLogP | 7.02 |
| TPSA | 87.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-1-phenylpropyl] 3-(azidomethyl)-2-phenylquinoline-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-phenylpropyl] 3-(azidomethyl)-2-phenylquinoline-4-carboxylate?
The IUPAC name of [(1S)-1-phenylpropyl] 3-(azidomethyl)-2-phenylquinoline-4-carboxylate (CID 59850127) is [(1S)-1-phenylpropyl] 3-(azidomethyl)-2-phenylquinoline-4-carboxylate.
What is the SMILES notation for [(1S)-1-phenylpropyl] 3-(azidomethyl)-2-phenylquinoline-4-carboxylate?
The canonical SMILES for [(1S)-1-phenylpropyl] 3-(azidomethyl)-2-phenylquinoline-4-carboxylate is CC[C@H](OC(=O)c1c(CN=[N+]=[N-])c(-c2ccccc2)nc2ccccc12)c1ccccc1.
What is the InChIKey of [(1S)-1-phenylpropyl] 3-(azidomethyl)-2-phenylquinoline-4-carboxylate?
The InChIKey is QLQPVMGBAWISLQ-QHCPKHFHSA-N. The full InChI is InChI=1S/C26H22N4O2/c1-2-23(18-11-5-3-6-12-18)32-26(31)24-20-15-9-10-16-22(20)29-25(21(24)17-28-30-27)19-13-7-4-8-14-19/h3-16,23H,2,17H2,1H3/t23-/m0/s1.
What are the key properties of [(1S)-1-phenylpropyl] 3-(azidomethyl)-2-phenylquinoline-4-carboxylate?
[(1S)-1-phenylpropyl] 3-(azidomethyl)-2-phenylquinoline-4-carboxylate has a molecular weight of 422.49 g/mol, XLogP of 7.02, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-phenylpropyl] 3-(azidomethyl)-2-phenylquinoline-4-carboxylate is sourced from PubChem (CID 59850127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).