C22H21ClN6O4S — CID 59851916
N-[2-[[4-[(9-chloro-6-oxo-5,7-dihydropyrimido[5,4-d][1]benzazepin-2-yl)amino]phenyl]sulfonylamino]ethyl]acetamide (PubChem CID 59851916) has the molecular formula C22H21ClN6O4S and a molecular weight of 500.97 g/mol. Its IUPAC name is N-[2-[[4-[(9-chloro-6-oxo-5,7-dihydropyrimido[5,4-d][1]benzazepin-2-yl)amino]phenyl]sulfonylamino]ethyl]acetamide.
| Compound Name | N-[2-[[4-[(9-chloro-6-oxo-5,7-dihydropyrimido[5,4-d][1]benzazepin-2-yl)amino]phenyl]sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 59851916 |
| Molecular Formula | C22H21ClN6O4S |
| Molecular Weight | 500.97 g/mol |
| Exact Mass | 500.10 |
| IUPAC Name | N-[2-[[4-[(9-chloro-6-oxo-5,7-dihydropyrimido[5,4-d][1]benzazepin-2-yl)amino]phenyl]sulfonylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNS(=O)(=O)c1ccc(Nc2ncc3c(n2)-c2ccc(Cl)cc2NC(=O)C3)cc1 |
| InChI | InChI=1S/C22H21ClN6O4S/c1-13(30)24-8-9-26-34(32,33)17-5-3-16(4-6-17)27-22-25-12-14-10-20(31)28-19-11-15(23)2-7-18(19)21(14)29-22/h2-7,11-12,26H,8-10H2,1H3,(H,24,30)(H,28,31)(H,25,27,29) |
| InChIKey | OHRFTMYDOWCFMB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 142.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.97 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|