C24H29FN4O4 — CID 59852847
tert-butyl N-[1-[(E)-3-[4-(4-amino-2-fluorophenoxy)-3-pyridinyl]prop-2-enoyl]piperidin-4-yl]carbamate (PubChem CID 59852847) has the molecular formula C24H29FN4O4 and a molecular weight of 456.52 g/mol. Its IUPAC name is tert-butyl N-[1-[(E)-3-[4-(4-amino-2-fluorophenoxy)-3-pyridinyl]prop-2-enoyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(E)-3-[4-(4-amino-2-fluorophenoxy)-3-pyridinyl]prop-2-enoyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 59852847 |
| Molecular Formula | C24H29FN4O4 |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | tert-butyl N-[1-[(E)-3-[4-(4-amino-2-fluorophenoxy)-3-pyridinyl]prop-2-enoyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(C(=O)/C=C/c2cnccc2Oc2ccc(N)cc2F)CC1 |
| InChI | InChI=1S/C24H29FN4O4/c1-24(2,3)33-23(31)28-18-9-12-29(13-10-18)22(30)7-4-16-15-27-11-8-20(16)32-21-6-5-17(26)14-19(21)25/h4-8,11,14-15,18H,9-10,12-13,26H2,1-3H3,(H,28,31)/b7-4+ |
| InChIKey | YIXJYBJOMLQWEM-QPJJXVBHSA-N |
| XLogP | 4.12 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|