C15H12BN5O2 — CID 59853638
CID 59853638 (PubChem CID 59853638) has the molecular formula C15H12BN5O2 and a molecular weight of 305.11 g/mol.
| Compound Name | CID 59853638 |
|---|---|
| PubChem CID | 59853638 |
| Molecular Formula | C15H12BN5O2 |
| Molecular Weight | 305.11 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | — |
| SMILES | [B]NC(=O)c1cccc(Nc2ncnn3cc(C=O)c(C)c23)c1 |
| InChI | InChI=1S/C15H12BN5O2/c1-9-11(7-22)6-21-13(9)14(17-8-18-21)19-12-4-2-3-10(5-12)15(23)20-16/h2-8H,1H3,(H,20,23)(H,17,18,19) |
| InChIKey | ZVIRUZASNIAMCN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 88.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.11 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|