C24H17Br3N2O3S — CID 59854769
3-benzyl-7,7-dibromo-2-(2-bromo-5-methoxyphenyl)-5,6-dihydro-[1]benzothiolo[2,3-d]pyrimidine-4,8-dione (PubChem CID 59854769) has the molecular formula C24H17Br3N2O3S and a molecular weight of 653.19 g/mol. Its IUPAC name is 3-benzyl-7,7-dibromo-2-(2-bromo-5-methoxyphenyl)-5,6-dihydro-[1]benzothiolo[2,3-d]pyrimidine-4,8-dione.
| Compound Name | 3-benzyl-7,7-dibromo-2-(2-bromo-5-methoxyphenyl)-5,6-dihydro-[1]benzothiolo[2,3-d]pyrimidine-4,8-dione |
|---|---|
| PubChem CID | 59854769 |
| Molecular Formula | C24H17Br3N2O3S |
| Molecular Weight | 653.19 g/mol |
| Exact Mass | 649.85 |
| IUPAC Name | 3-benzyl-7,7-dibromo-2-(2-bromo-5-methoxyphenyl)-5,6-dihydro-[1]benzothiolo[2,3-d]pyrimidine-4,8-dione |
| SMILES | COc1ccc(Br)c(-c2nc3sc4c(c3c(=O)n2Cc2ccccc2)CCC(Br)(Br)C4=O)c1 |
| InChI | InChI=1S/C24H17Br3N2O3S/c1-32-14-7-8-17(25)16(11-14)21-28-22-18(15-9-10-24(26,27)20(30)19(15)33-22)23(31)29(21)12-13-5-3-2-4-6-13/h2-8,11H,9-10,12H2,1H3 |
| InChIKey | XDQNQTPJPLOXTR-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.19 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|